4-Chloro-2-methoxy-5-nitro-benzoic acid methyl ester structure
|
Common Name | 4-Chloro-2-methoxy-5-nitro-benzoic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 109069-75-2 | Molecular Weight | 245.61700 | |
| Density | 1.402g/cm3 | Boiling Point | 376.9ºC at 760 mmHg | |
| Molecular Formula | C9H8ClNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.7ºC | |
| Name | Methyl 4-chloro-2-methoxy-5-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.402g/cm3 |
|---|---|
| Boiling Point | 376.9ºC at 760 mmHg |
| Molecular Formula | C9H8ClNO5 |
| Molecular Weight | 245.61700 |
| Flash Point | 181.7ºC |
| Exact Mass | 245.00900 |
| PSA | 81.35000 |
| LogP | 2.56660 |
| Vapour Pressure | 7.03E-06mmHg at 25°C |
| Index of Refraction | 1.554 |
| InChIKey | SPSVQVKAYOHSBJ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc([N+](=O)[O-])c(Cl)cc1OC |
| HS Code | 2918990090 |
|---|
|
~%
4-Chloro-2-meth... CAS#:109069-75-2 |
| Literature: Eisai Co., Ltd. Patent: US6518423 B1, 2003 ; |
|
~%
4-Chloro-2-meth... CAS#:109069-75-2 |
| Literature: Loudon,J.D.; Smith,D.M. Journal of the Chemical Society, 1964 , p. 2806 - 2810 |
|
~%
4-Chloro-2-meth... CAS#:109069-75-2 |
| Literature: Ogata, Masaru; Matsumoto, Hiroshi; Kida, Shiro; Shiomi, Teruo; Eigyo, Masami; Hirose, Katsumi Journal of Medicinal Chemistry, 1984 , vol. 27, # 9 p. 1137 - 1141 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| methyl 4-chloro-5-nitro-o-anisate |
| Benzoic acid,4-chloro-2-methoxy-5-nitro-,methyl ester |
| 4-chloro-2-methoxy-5-nitro-benzoic acid methyl ester |
| 4-Chlor-2-methoxy-5-nitro-benzoesaeure-methylester |