1H-Purine-2,6-dione,3,7-dihydro-1-hydroxy-8-(methylthio)-7-(phenylmethyl)- structure
|
Common Name | 1H-Purine-2,6-dione,3,7-dihydro-1-hydroxy-8-(methylthio)-7-(phenylmethyl)- | ||
|---|---|---|---|---|
| CAS Number | 1091-72-1 | Molecular Weight | 304.32400 | |
| Density | 1.57g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H12N4O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-benzyl-1-hydroxy-8-methylsulfanyl-3H-purine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.57g/cm3 |
|---|---|
| Molecular Formula | C13H12N4O3S |
| Molecular Weight | 304.32400 |
| Exact Mass | 304.06300 |
| PSA | 118.21000 |
| LogP | 0.89380 |
| Index of Refraction | 1.755 |
| InChIKey | PDCWDPJIFWRJKS-UHFFFAOYSA-N |
| SMILES | CSc1nc2[nH]c(=O)n(O)c(=O)c2n1Cc1ccccc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Hydroxy-8-methylmercapto-7-benzyl-xanthin |
| 7-benzyl-1-hydroxy-8-methylsulfanyl-3,7-dihydro-purine-2,6-dione |
| HMS3085F21 |