Benzene,1,1'-methylenebis[4-iodo-2-nitro structure
|
Common Name | Benzene,1,1'-methylenebis[4-iodo-2-nitro | ||
|---|---|---|---|---|
| CAS Number | 1092-56-4 | Molecular Weight | 510.02300 | |
| Density | 2.155g/cm3 | Boiling Point | 485.5ºC at 760mmHg | |
| Molecular Formula | C13H8I2N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.4ºC | |
| Name | 4-iodo-1-[(4-iodo-2-nitrophenyl)methyl]-2-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.155g/cm3 |
|---|---|
| Boiling Point | 485.5ºC at 760mmHg |
| Molecular Formula | C13H8I2N2O4 |
| Molecular Weight | 510.02300 |
| Flash Point | 247.4ºC |
| Exact Mass | 509.85700 |
| PSA | 91.64000 |
| LogP | 5.34940 |
| Vapour Pressure | 4.15E-09mmHg at 25°C |
| Index of Refraction | 1.73 |
| InChIKey | SCJKFZVYCPRQEH-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(I)ccc1Cc1ccc(I)cc1[N+](=O)[O-] |
|
~%
Benzene,1,1'-me... CAS#:1092-56-4 |
| Literature: Catala,A.; Popp,F.D. Journal of Heterocyclic Chemistry, 1964 , vol. 1, p. 178 - 181 |
|
~%
Benzene,1,1'-me... CAS#:1092-56-4 |
| Literature: Catala,A.; Popp,F.D. Journal of Heterocyclic Chemistry, 1964 , vol. 1, p. 178 - 181 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 1,1'-methanediylbis(4-iodo-2-nitrobenzene) |
| 2.2'-Dinitro-4.4'-diiod-diphenylmethan |
| 4,4'-Diiod-2,2'-dinitro-diphenylmethan |
| 4,4'-diiodo-2,2'-dinitrodiphenylmethane |