Ethyldipentyltin acetate
Modify Date: 2026-07-05 13:30:59
Ethyldipentyltin acetate structure
|
Common Name | Ethyldipentyltin acetate | ||
|---|---|---|---|---|
| CAS Number | 109222-27-7 | Molecular Weight | 349.10 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H30O2Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyldipentyltin acetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H30O2Sn |
|---|---|
| Molecular Weight | 349.10 |
| InChIKey | BJWJIFVMGZDKPG-UHFFFAOYSA-M |
| SMILES | CCCCC[Sn](CC)(CCCCC)OC(C)=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 109222-27-7? |
| A: Chinese name of 109222-27-7 is 109222-27-7. |
| Q: What is the molecular formula of Ethyldipentyltin acetate? |
| A: Molecular formula of Ethyldipentyltin acetate is C14H30O2Sn. |
| Q: What is the molecular weight of Ethyldipentyltin acetate? |
| A: Molecular weight of Ethyldipentyltin acetate is 349.10. |
| Q: What is the CAS number of Ethyldipentyltin acetate? |
| A: CAS number of Ethyldipentyltin acetate is 109222-27-7. |
| Q: What is the English name of Ethyldipentyltin acetate? |
| A: The English name of Ethyldipentyltin acetate is Ethyldipentyltin acetate. |
| Q: What is the InChIKey of Ethyldipentyltin acetate? |
| A: InChIKey of Ethyldipentyltin acetate is BJWJIFVMGZDKPG-UHFFFAOYSA-M. |
| Q: What is the SMILES notation of Ethyldipentyltin acetate? |
| A: SMILES notation of Ethyldipentyltin acetate is CCCCC[Sn](CC)(CCCCC)OC(C)=O. |