Isobutyl-5-chloro-2,2-dimethylvalerate
Isobutyl-5-chloro-2,2-dimethylvalerate structure
|
Common Name | Isobutyl-5-chloro-2,2-dimethylvalerate | ||
|---|---|---|---|---|
| CAS Number | 109232-37-3 | Molecular Weight | 220.736 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 266.4±13.0 °C at 760 mmHg | |
| Molecular Formula | C11H21ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 115.1±15.3 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-methylpropyl 5-chloro-2,2-dimethylpentanoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 266.4±13.0 °C at 760 mmHg |
| Molecular Formula | C11H21ClO2 |
| Molecular Weight | 220.736 |
| Flash Point | 115.1±15.3 °C |
| Exact Mass | 220.123001 |
| PSA | 26.30000 |
| LogP | 3.56 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.441 |
| InChIKey | KPAZLWVDWUAYII-UHFFFAOYSA-N |
| SMILES | CC(C)COC(=O)C(C)(C)CCCCl |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2915900090 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5-Chloro-2,2-dimethyl-pentanoic acid isobutyl ester |
| Isobutyl 5-chloro-2,2-dimethylvalerate |
| 2-Methylpropyl-5-chlor-2,2-dimethylpentanoat |
| G3X1&1&VO1Y1&1 |
| Pentanoic acid,5-chloro-2,2-dimethyl-,2-methylpropyl ester |
| Isobutyl-5-chloro-2,2-dimethylvalerate |
| 2-Methylpropyl 5-chloro-2,2-dimethylpentanoate |
| Pentanoic acid, 5-chloro-2,2-dimethyl-, 2-methylpropyl ester |
| Isobutyl 5-chloro-2,2-dimethylpentanoate |
| MFCD03265308 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 2-methylpropyl 5-chloro-2,2-dimethylpentanoate? |
| A: LogP of 2-methylpropyl 5-chloro-2,2-dimethylpentanoate is 3.56. |
| Q: What is the InChIKey of 2-methylpropyl 5-chloro-2,2-dimethylpentanoate? |
| A: InChIKey of 2-methylpropyl 5-chloro-2,2-dimethylpentanoate is KPAZLWVDWUAYII-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 2-methylpropyl 5-chloro-2,2-dimethylpentanoate? |
| A: Polar surface area (PSA) of 2-methylpropyl 5-chloro-2,2-dimethylpentanoate is 26.30000. |
| Q: What is the molecular weight of 2-methylpropyl 5-chloro-2,2-dimethylpentanoate? |
| A: Molecular weight of 2-methylpropyl 5-chloro-2,2-dimethylpentanoate is 220.736. |
| Q: What is the molecular formula of 2-methylpropyl 5-chloro-2,2-dimethylpentanoate? |
| A: Molecular formula of 2-methylpropyl 5-chloro-2,2-dimethylpentanoate is C11H21ClO2. |
| Q: What is the CAS number of 2-methylpropyl 5-chloro-2,2-dimethylpentanoate? |
| A: CAS number of 2-methylpropyl 5-chloro-2,2-dimethylpentanoate is 109232-37-3. |
| Q: What is the boiling point of 2-methylpropyl 5-chloro-2,2-dimethylpentanoate? |
| A: Boiling point of 2-methylpropyl 5-chloro-2,2-dimethylpentanoate is 266.4±13.0 °C at 760 mmHg. |
| Q: What English synonyms does 2-methylpropyl 5-chloro-2,2-dimethylpentanoate have? |
| A: English synonyms of 2-methylpropyl 5-chloro-2,2-dimethylpentanoate: 5-Chloro-2,2-dimethyl-pentanoic acid isobutyl ester, Isobutyl 5-chloro-2,2-dimethylvalerate, 2-Methylpropyl-5-chlor-2,2-dimethylpentanoat, G3X1&1&VO1Y1&1, Pentanoic acid,5-chloro-2,2-dimethyl-,2-methylpropyl ester, Isobutyl-5-chloro-2,2-dimethylvalerate, 2-Methylpropyl 5-chloro-2,2-dimethylpentanoate, Pentanoic acid, 5-chloro-2,2-dimethyl-, 2-methylpropyl ester, Isobutyl 5-chloro-2,2-dimethylpentanoate, MFCD03265308. |
| Q: What is the English name of 2-methylpropyl 5-chloro-2,2-dimethylpentanoate? |
| A: The English name of 2-methylpropyl 5-chloro-2,2-dimethylpentanoate is 2-methylpropyl 5-chloro-2,2-dimethylpentanoate. |
| Q: What is the SMILES notation of 2-methylpropyl 5-chloro-2,2-dimethylpentanoate? |
| A: SMILES notation of 2-methylpropyl 5-chloro-2,2-dimethylpentanoate is CC(C)COC(=O)C(C)(C)CCCCl. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |
| Henan Tianfu Chemical Co., Ltd. |