diflufenzopyr structure
|
Common Name | diflufenzopyr | ||
|---|---|---|---|---|
| CAS Number | 109293-97-2 | Molecular Weight | 334.27800 | |
| Density | 1.43g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H12F2N4O3 | Melting Point | 135.5ºC; decomp at 155ºC | |
| MSDS | N/A | Flash Point | 150 °C | |
| Name | diflufenzopyr |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Melting Point | 135.5ºC; decomp at 155ºC |
| Molecular Formula | C15H12F2N4O3 |
| Molecular Weight | 334.27800 |
| Flash Point | 150 °C |
| Exact Mass | 334.08800 |
| PSA | 103.68000 |
| LogP | 3.06760 |
| Index of Refraction | 1.612 |
| InChIKey | IRJQWZWMQCVOLA-UHFFFAOYSA-N |
| SMILES | CC(=NNC(=O)Nc1cc(F)cc(F)c1)c1ncccc1C(=O)O |
| Storage condition | 0-6°C |
| RTECS | US5648931 |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| BAS654H |
| SAN 835H |
| Diflufenzopyr |
| 2-[N-[(3,5-difluorophenyl)carbamoylamino]-C-methylcarbonimidoyl]pyridine-3-carboxylic acid |
| 2-[(1E)-1-[2-[[(3,5-difluorophenyl)amino]carbonyl]hydrazinylidene]ethyl]-3-pyridinecarboxylic acid |
| 2-[(1E)-1-{2-[(3,5-difluorophenyl)carbamoyl]hydrazinylidene}ethyl]pyridine-3-carboxylic acid |
| 2-{(E)-1-[4-(3,5-difluorophenyl)semicarbazono]ethyl}nicotinic acid |