tert-Butyl 4-(3,3-difluoroazetidin-1-yl)piperidine-1-carboxylate structure
|
Common Name | tert-Butyl 4-(3,3-difluoroazetidin-1-yl)piperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1093066-74-0 | Molecular Weight | 276.323 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 319.0±42.0 °C at 760 mmHg | |
| Molecular Formula | C13H22F2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146.7±27.9 °C | |
| Name | tert-Butyl 4-(3,3-difluoroazetidin-1-yl)piperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 319.0±42.0 °C at 760 mmHg |
| Molecular Formula | C13H22F2N2O2 |
| Molecular Weight | 276.323 |
| Flash Point | 146.7±27.9 °C |
| Exact Mass | 276.164948 |
| PSA | 32.78000 |
| LogP | 0.46 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.494 |
| InChIKey | RIGPUFYOEHVLIA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(N2CC(F)(F)C2)CC1 |
| HS Code | 2933990090 |
|---|
|
~87%
tert-Butyl 4-(3... CAS#:1093066-74-0 |
| Literature: WO2008/152394 A1, ; Page/Page column 45 ; WO 2008/152394 A1 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Piperidinecarboxylic acid, 4-(3,3-difluoro-1-azetidinyl)-, 1,1-dimethylethyl ester |
| tert-butyl 4-(3,3-difluoroazetidin-1-yl)piperidine-1-carboxylate |
| 2-Methyl-2-propanyl 4-(3,3-difluoro-1-azetidinyl)-1-piperidinecarboxylate |