4-Methyl-3-oxo-piperazine-1-carboxylic acid tert-butyl ester structure
|
Common Name | 4-Methyl-3-oxo-piperazine-1-carboxylic acid tert-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 109384-26-1 | Molecular Weight | 214.26200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H18N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl 4-methyl-3-oxopiperazine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H18N2O3 |
|---|---|
| Molecular Weight | 214.26200 |
| Exact Mass | 214.13200 |
| PSA | 49.85000 |
| LogP | 0.57130 |
| InChIKey | SLWXQUHGEUNYSN-UHFFFAOYSA-N |
| SMILES | CN1CCN(C(=O)OC(C)(C)C)CC1=O |
| HS Code | 2933599090 |
|---|
|
~95%
4-Methyl-3-oxo-... CAS#:109384-26-1 |
| Literature: EP1591443 A1, ; Page/Page column 63 ; |
|
~72%
4-Methyl-3-oxo-... CAS#:109384-26-1 |
| Literature: EP1621537 A1, ; Page/Page column 47; 52 ; |
|
~%
Detail
|
| Literature: EP202048 B1, ; |
|
~%
4-Methyl-3-oxo-... CAS#:109384-26-1 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 21, # 12 p. 3809 - 3812 |
|
~%
4-Methyl-3-oxo-... CAS#:109384-26-1 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 18, # 11 p. 3236 - 3241 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-tert-butoxycarbonyl-4-methyl-3-oxopiperazine |
| 4-Methyl-3-oxopiperazine-1-carboxylic acid tert-butyl ester |
| C-2153 |
| 1-methyl-2-oxo-4-t-butoxycarbonylpiperazine |