[1-(benzenesulfonyl)-3,4-dimethylidenecyclohexyl]sulfonylbenzene structure
|
Common Name | [1-(benzenesulfonyl)-3,4-dimethylidenecyclohexyl]sulfonylbenzene | ||
|---|---|---|---|---|
| CAS Number | 109432-99-7 | Molecular Weight | 388.50000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H20O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [1-(benzenesulfonyl)-3,4-dimethylidenecyclohexyl]sulfonylbenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H20O4S2 |
|---|---|
| Molecular Weight | 388.50000 |
| Exact Mass | 388.08000 |
| PSA | 85.04000 |
| LogP | 6.08840 |
| InChIKey | HORCGVLZODLVLS-UHFFFAOYSA-N |
| SMILES | C=C1CCC(S(=O)(=O)c2ccccc2)(S(=O)(=O)c2ccccc2)CC1=C |
|
~82%
[1-(benzenesulf... CAS#:109432-99-7 |
| Literature: Trost, Barry M.; Tour, James M. Journal of the American Chemical Society, 1987 , vol. 109, # 17 p. 5268 - 5270 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Benzene,1,1'-[[3,4-bis(methylene)cyclohexylidene]bis(sulfonyl)]bis |