6-[ethyl(pentoxy)phosphoryl]oxyhexyl-hydroxy-methyl-sulfanylidene-λ5-phosphane structure
|
Common Name | 6-[ethyl(pentoxy)phosphoryl]oxyhexyl-hydroxy-methyl-sulfanylidene-λ5-phosphane | ||
|---|---|---|---|---|
| CAS Number | 109438-26-8 | Molecular Weight | 358.41400 | |
| Density | 1.099g/cm3 | Boiling Point | 472ºC at 760mmHg | |
| Molecular Formula | C14H32O4P2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.3ºC | |
| Name | 6-[ethyl(pentoxy)phosphoryl]oxyhexyl-hydroxy-methyl-sulfanylidene-λ5-phosphane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.099g/cm3 |
|---|---|
| Boiling Point | 472ºC at 760mmHg |
| Molecular Formula | C14H32O4P2S |
| Molecular Weight | 358.41400 |
| Flash Point | 239.3ºC |
| Exact Mass | 358.15000 |
| PSA | 107.47000 |
| LogP | 5.65040 |
| Vapour Pressure | 6.82E-11mmHg at 25°C |
| Index of Refraction | 1.481 |
| InChIKey | DNVLDPOHTBGMFU-UHFFFAOYSA-N |
| SMILES | CCCCCOP(=O)(CC)OCCCCCCP(C)(O)=S |
| Ethylphosphonothioic acid anhydride with ethylphosphonic acid dipentyl ester |
| (ethylphosphonic acid pentyl ester)-(ethyl-thiophosphonic acid O-pentyl ester)-anhydride |
| Dwuetylo-tiopirofosfonian dwuamylowy [Polish] |
| Phosphonothioic acid,ethyl-,anhydride with ethylphosphonic acid,dipentyl ester |
| (Aethylphosphonsaeure-pentylester)-(aethyl-thiophosphonsaeure-O-pentylester)-anhydrid |
| 6-[ethyl(pentoxy)phosphoryl]oxyhexyl-hydroxy-methyl-sulfanylidene |
| Dwuetylo-tiopirofosfonian dwuamylowy |