1-(3-hydroxy-5-phenylmethoxyindol-1-yl)ethanone structure
|
Common Name | 1-(3-hydroxy-5-phenylmethoxyindol-1-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 109448-27-3 | Molecular Weight | 281.30600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(3-hydroxy-5-phenylmethoxyindol-1-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H15NO3 |
|---|---|
| Molecular Weight | 281.30600 |
| Exact Mass | 281.10500 |
| PSA | 51.46000 |
| LogP | 3.58600 |
| InChIKey | GANRJEYGYLUKOL-UHFFFAOYSA-N |
| SMILES | CC(=O)n1cc(O)c2cc(OCc3ccccc3)ccc21 |
|
~%
1-(3-hydroxy-5-... CAS#:109448-27-3 |
| Literature: Holt et al. Journal of the Chemical Society, 1958 , p. 1217,1222 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 1-acetyl-5-benzyloxy-indol-3-ol |
| 1H-Indol-3-ol,1-acetyl-5-(phenylmethoxy) |
| N-acetyl-5-benzyloxy-1,2-dihydro-3H-indol-3-one |