10-methyl-(20RS)-camptothecin structure
|
Common Name | 10-methyl-(20RS)-camptothecin | ||
|---|---|---|---|---|
| CAS Number | 109467-01-8 | Molecular Weight | 362.37900 | |
| Density | 1.47g/cm3 | Boiling Point | 756.3ºC at 760mmHg | |
| Molecular Formula | C21H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 411.2ºC | |
| Name | 10-methyl-(20RS)-camptothecin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 756.3ºC at 760mmHg |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.37900 |
| Flash Point | 411.2ºC |
| Exact Mass | 362.12700 |
| PSA | 81.42000 |
| LogP | 2.38800 |
| Vapour Pressure | 4.9E-24mmHg at 25°C |
| Index of Refraction | 1.729 |
| InChIKey | FREMMFBXXMQTKV-UHFFFAOYSA-N |
| SMILES | CCC1(O)C(=O)OCc2c1cc1n(c2=O)Cc2cc3cc(C)ccc3nc2-1 |
|
~%
10-methyl-(20RS... CAS#:109467-01-8 |
| Literature: Wani; Nicholas; Manikumar; Wall Journal of Medicinal Chemistry, 1987 , vol. 30, # 10 p. 1774 - 1779 |
|
~%
10-methyl-(20RS... CAS#:109467-01-8 |
| Literature: Wani; Nicholas; Manikumar; Wall Journal of Medicinal Chemistry, 1987 , vol. 30, # 10 p. 1774 - 1779 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 10-methyl-20(RS)-camptothecin |
| 1H-Pyrano(3',4':6,7)indolizino(1,2-b)quinoline-3,14(4H,12H)-dione,4-ethyl-4-hydroxy-9-methyl |