2,3-Bis(phenylmethoxymethyl)butane-1,4-disulfonic acid
Modify Date: 2025-09-09 21:24:07
2,3-Bis(phenylmethoxymethyl)butane-1,4-disulfonic acid structure
|
Common Name | 2,3-Bis(phenylmethoxymethyl)butane-1,4-disulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 109582-30-1 | Molecular Weight | 458.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H26O8S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3-Bis(phenylmethoxymethyl)butane-1,4-disulfonic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H26O8S2 |
|---|---|
| Molecular Weight | 458.5 |
| InChIKey | LTCBZKRIFXLAJY-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)CC(COCc1ccccc1)C(COCc1ccccc1)CS(=O)(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2,3-Bis(phenylmethoxymethyl)butane-1,4-disulfonic acid? |
| A: SMILES notation of 2,3-Bis(phenylmethoxymethyl)butane-1,4-disulfonic acid is O=S(=O)(O)CC(COCc1ccccc1)C(COCc1ccccc1)CS(=O)(=O)O. |
| Q: What is the CAS number of 2,3-Bis(phenylmethoxymethyl)butane-1,4-disulfonic acid? |
| A: CAS number of 2,3-Bis(phenylmethoxymethyl)butane-1,4-disulfonic acid is 109582-30-1. |
| Q: What is the molecular weight of 2,3-Bis(phenylmethoxymethyl)butane-1,4-disulfonic acid? |
| A: Molecular weight of 2,3-Bis(phenylmethoxymethyl)butane-1,4-disulfonic acid is 458.5. |
| Q: What is the Chinese name of 109582-30-1? |
| A: Chinese name of 109582-30-1 is 109582-30-1. |
| Q: What is the English name of 2,3-Bis(phenylmethoxymethyl)butane-1,4-disulfonic acid? |
| A: The English name of 2,3-Bis(phenylmethoxymethyl)butane-1,4-disulfonic acid is 2,3-Bis(phenylmethoxymethyl)butane-1,4-disulfonic acid. |
| Q: What is the InChIKey of 2,3-Bis(phenylmethoxymethyl)butane-1,4-disulfonic acid? |
| A: InChIKey of 2,3-Bis(phenylmethoxymethyl)butane-1,4-disulfonic acid is LTCBZKRIFXLAJY-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2,3-Bis(phenylmethoxymethyl)butane-1,4-disulfonic acid? |
| A: Molecular formula of 2,3-Bis(phenylmethoxymethyl)butane-1,4-disulfonic acid is C20H26O8S2. |