4-amino-3-[(4-chlorophenyl)methoxy]benzoic acid structure
|
Common Name | 4-amino-3-[(4-chlorophenyl)methoxy]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 1096330-77-6 | Molecular Weight | 277.70300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-amino-3-[(4-chlorophenyl)methoxy]benzoic acid |
|---|
| Molecular Formula | C14H12ClNO3 |
|---|---|
| Molecular Weight | 277.70300 |
| Exact Mass | 277.05100 |
| PSA | 72.55000 |
| LogP | 3.78060 |
| InChIKey | HGIYLHFYBHMVLN-UHFFFAOYSA-N |
| SMILES | Nc1ccc(C(=O)O)cc1OCc1ccc(Cl)cc1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |