Ethanol, 2-chloro-, phosphate (3:1), polymer with oxirane and phosphorus oxide (P2O5) structure
|
Common Name | Ethanol, 2-chloro-, phosphate (3:1), polymer with oxirane and phosphorus oxide (P2O5) | ||
|---|---|---|---|---|
| CAS Number | 109640-81-5 | Molecular Weight | 471.48700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H16Cl3O10P3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethanol, 2-chloro-, phosphate (3:1), polymer with oxirane and phosphorus oxide (P2O5) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H16Cl3O10P3 |
|---|---|
| Molecular Weight | 471.48700 |
| Exact Mass | 469.90200 |
| PSA | 212.89000 |
| LogP | 4.05610 |
| InChIKey | ABGXDFDVHPVXQI-UHFFFAOYSA-N |
| SMILES | C1CO1.O=P(=O)OP(=O)=O.O=P(OCCCl)(OCCCl)OCCCl |
| Ethanol,2-chloro-,phosphate (3:1),polymer with phosphorus oxide (P2O5) and ethylene oxide |
| Ethanol,2-chloro-,1,1',1''-phosphate,polymer with oxirane and phosphorus oxide (P2O5) |