4-amino-N-(4-ethoxyphenyl)benzamide,hydrochloride structure
|
Common Name | 4-amino-N-(4-ethoxyphenyl)benzamide,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 109651-02-7 | Molecular Weight | 292.76100 | |
| Density | 1.214g/cm3 | Boiling Point | 374ºC at 760mmHg | |
| Molecular Formula | C15H17ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180ºC | |
| Name | 4-amino-N-(4-ethoxyphenyl)benzamide,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.214g/cm3 |
|---|---|
| Boiling Point | 374ºC at 760mmHg |
| Molecular Formula | C15H17ClN2O2 |
| Molecular Weight | 292.76100 |
| Flash Point | 180ºC |
| Exact Mass | 292.09800 |
| PSA | 64.35000 |
| LogP | 4.37600 |
| Vapour Pressure | 8.63E-06mmHg at 25°C |
| Index of Refraction | 1.643 |
| InChIKey | WNXZDXDCJNQWQN-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(NC(=O)c2ccc(N)cc2)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-amino-N-(4-ethoxyphenyl)benzamide hydrochloride |
| 4-amino-benzoic acid p-phenetidide |
| 4-Amino-benzoesaeure-p-phenetidid |