2-[(2,3-dihydro-1,4-benzodioxin-6-yl)amino]-N,N-dimethylpropanamide
Modify Date: 2025-09-24 17:11:08
![2-[(2,3-dihydro-1,4-benzodioxin-6-yl)amino]-N,N-dimethylpropanamide Structure](https://www.chemsrc.com/extcaspic/414/1097262-33-3.png)
2-[(2,3-dihydro-1,4-benzodioxin-6-yl)amino]-N,N-dimethylpropanamide structure
|
Common Name | 2-[(2,3-dihydro-1,4-benzodioxin-6-yl)amino]-N,N-dimethylpropanamide | ||
|---|---|---|---|---|
| CAS Number | 1097262-33-3 | Molecular Weight | 250.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[(2,3-dihydro-1,4-benzodioxin-6-yl)amino]-N,N-dimethylpropanamide |
|---|
| Molecular Formula | C13H18N2O3 |
|---|---|
| Molecular Weight | 250.29 |
| InChIKey | BAJUTRFUGVRUNJ-UHFFFAOYSA-N |
| SMILES | CC(Nc1ccc2c(c1)OCCO2)C(=O)N(C)C |
|
Name: Antimycobacterial activity against Mycobacterium tuberculosis H37Rv
Source: ChEMBL
Target: Mycobacterium tuberculosis
External Id: CHEMBL4620623
|
|
Name: Lipophilicity, log D of the compound at pH 7.4
Source: ChEMBL
Target: N/A
External Id: CHEMBL4620622
|
|
Name: Inhibition of Mycobacterium tuberculosis DprE1
Source: ChEMBL
Target: N/A
External Id: CHEMBL4620624
|
Total 3, Current Page 1 of 1
1