1-methyl-5-[(4-methylphenyl)methylidene]imidazolidine-2,4-dione structure
|
Common Name | 1-methyl-5-[(4-methylphenyl)methylidene]imidazolidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 109754-15-6 | Molecular Weight | 216.23600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methyl-5-[(4-methylphenyl)methylidene]imidazolidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H12N2O2 |
|---|---|
| Molecular Weight | 216.23600 |
| Exact Mass | 216.09000 |
| PSA | 52.90000 |
| LogP | 1.73130 |
| InChIKey | YQXSGBMEYWQSPA-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C=C2C(=O)NC(=O)N2C)cc1 |
|
~%
1-methyl-5-[(4-... CAS#:109754-15-6 |
| Literature: Tan, Sau-Fun; Ang, Kok-Peng; How, Gee-Fung Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1988 , p. 2045 - 2050 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,4-Imidazolidinedione,1-methyl-5-[(4-methylphenyl)methylene]-,(Z) |