N-phenylacetyl-2-(2-chlorophenyl)-D-glycine
Modify Date: 2025-09-13 17:51:54
N-phenylacetyl-2-(2-chlorophenyl)-D-glycine structure
|
Common Name | N-phenylacetyl-2-(2-chlorophenyl)-D-glycine | ||
|---|---|---|---|---|
| CAS Number | 1098100-07-2 | Molecular Weight | 303.74000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2R)-2-(2-chlorophenyl)-2-[(2-phenylacetyl)amino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H14ClNO3 |
|---|---|
| Molecular Weight | 303.74000 |
| Exact Mass | 303.06600 |
| PSA | 69.89000 |
| LogP | 3.66490 |
| InChIKey | MTFPCYJZWDSFOB-OAHLLOKOSA-N |
| SMILES | O=C(Cc1ccccc1)NC(C(=O)O)c1ccccc1Cl |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-PHENYLACETYL-2-(2-CHLOROPHENYL)-D-GLYCINE |
| (R)-2-(2-chlorophenyl)-2-[(2-phenylacetyl)amino]ethanoic acid |