2-[2-Amino(methyl)-4-(trifluoromethyl)anilino]-1-ethanol structure
|
Common Name | 2-[2-Amino(methyl)-4-(trifluoromethyl)anilino]-1-ethanol | ||
|---|---|---|---|---|
| CAS Number | 1098343-69-1 | Molecular Weight | 234.21800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13F3N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[2-Amino(methyl)-4-(trifluoromethyl)anilino]-1-ethanol |
|---|
| Molecular Formula | C10H13F3N2O |
|---|---|
| Molecular Weight | 234.21800 |
| Exact Mass | 234.09800 |
| PSA | 49.49000 |
| LogP | 2.29730 |
| InChIKey | JXBZOMYIVXCZKV-UHFFFAOYSA-N |
| SMILES | CN(CCO)c1ccc(C(F)(F)F)cc1N |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |