Benzenesulfonamide, N,N'-methylenebis[N,4-dimethyl structure
|
Common Name | Benzenesulfonamide, N,N'-methylenebis[N,4-dimethyl | ||
|---|---|---|---|---|
| CAS Number | 1099-76-9 | Molecular Weight | 382.49800 | |
| Density | 1.285g/cm3 | Boiling Point | 530.7ºC at 760mmHg | |
| Molecular Formula | C17H22N2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.7ºC | |
| Name | N,4-dimethyl-N-[[methyl-(4-methylphenyl)sulfonylamino]methyl]benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.285g/cm3 |
|---|---|
| Boiling Point | 530.7ºC at 760mmHg |
| Molecular Formula | C17H22N2O4S2 |
| Molecular Weight | 382.49800 |
| Flash Point | 274.7ºC |
| Exact Mass | 382.10200 |
| PSA | 91.52000 |
| LogP | 4.36370 |
| Vapour Pressure | 2.41E-11mmHg at 25°C |
| Index of Refraction | 1.587 |
| InChIKey | MBPUESRHKGVTCP-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N(C)CN(C)S(=O)(=O)c2ccc(C)cc2)cc1 |
|
~%
Benzenesulfonam... CAS#:1099-76-9 |
| Literature: McMaster Journal of the American Chemical Society, 1934 , vol. 56, p. 204 |
|
~%
Benzenesulfonam... CAS#:1099-76-9 |
| Literature: Sekera,A.; Rumpf,P. Comptes Rendus Hebdomadaires des Seances de l'Academie des Sciences, 1965 , vol. 260, p. 2252 - 2254 |
| N,N'-Dimethyl-N,N'-methandiyl-bis-toluol-4-sulfonamid |
| N,N'-dimethyl-N,N'-methanediyl-bis-toluene-4-sulfonamide |