Dihexyl adipate
Dihexyl adipate structure
|
Common Name | Dihexyl adipate | ||
|---|---|---|---|---|
| CAS Number | 110-33-8 | Molecular Weight | 314.460 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 351.3±10.0 °C at 760 mmHg | |
| Molecular Formula | C18H34O4 | Melting Point | -13.8°C | |
| MSDS | N/A | Flash Point | 157.5±17.4 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | dihexyl hexanedioate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 351.3±10.0 °C at 760 mmHg |
| Melting Point | -13.8°C |
| Molecular Formula | C18H34O4 |
| Molecular Weight | 314.460 |
| Flash Point | 157.5±17.4 °C |
| Exact Mass | 314.245697 |
| PSA | 52.60000 |
| LogP | 6.34 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.448 |
| InChIKey | HHECSPXBQJHZAF-UHFFFAOYSA-N |
| SMILES | CCCCCCOC(=O)CCCCC(=O)OCCCCCC |
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| EINECS 203-757-7 |
| Hexanedioic acid, dihexyl ester |
| Adipinsaeure-dihexylester |
| Plasticizer dihexyl adipate |
| dihexyladipate |
| adipic acid dihexyl ester |
| hexanedioic acid,dihexyl ester |
| Dihexyl adipate |
| dihexyl hexanedioate |
| Di-n-hexyl adipate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of dihexyl hexanedioate? |
| A: InChIKey of dihexyl hexanedioate is HHECSPXBQJHZAF-UHFFFAOYSA-N. |
| Q: What is the LogP of dihexyl hexanedioate? |
| A: LogP of dihexyl hexanedioate is 6.34. |
| Q: What is the CAS number of dihexyl hexanedioate? |
| A: CAS number of dihexyl hexanedioate is 110-33-8. |
| Q: What is the melting point of dihexyl hexanedioate? |
| A: Melting point of dihexyl hexanedioate is -13.8°C. |
| Q: What is the molecular weight of dihexyl hexanedioate? |
| A: Molecular weight of dihexyl hexanedioate is 314.460. |
| Q: What is the English name of dihexyl hexanedioate? |
| A: The English name of dihexyl hexanedioate is dihexyl hexanedioate. |
| Q: What is the SMILES notation of dihexyl hexanedioate? |
| A: SMILES notation of dihexyl hexanedioate is CCCCCCOC(=O)CCCCC(=O)OCCCCCC. |
| Q: What English synonyms does dihexyl hexanedioate have? |
| A: English synonyms of dihexyl hexanedioate: EINECS 203-757-7, Hexanedioic acid, dihexyl ester, Adipinsaeure-dihexylester, Plasticizer dihexyl adipate, dihexyladipate, adipic acid dihexyl ester, hexanedioic acid,dihexyl ester, Dihexyl adipate, dihexyl hexanedioate, Di-n-hexyl adipate. |
| Q: What is the molecular formula of dihexyl hexanedioate? |
| A: Molecular formula of dihexyl hexanedioate is C18H34O4. |
| Q: What is the boiling point of dihexyl hexanedioate? |
| A: Boiling point of dihexyl hexanedioate is 351.3±10.0 °C at 760 mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |