(25R)-3β,26-Dihydroxy-5α-furost-20(22)-en-12-one structure
|
Common Name | (25R)-3β,26-Dihydroxy-5α-furost-20(22)-en-12-one | ||
|---|---|---|---|---|
| CAS Number | 11005-20-2 | Molecular Weight | 430.62000 | |
| Density | 1.112g/cm3 | Boiling Point | 572.4ºC at 760mmHg | |
| Molecular Formula | C27H42O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186ºC | |
| Name | Pseudohecogenin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.112g/cm3 |
|---|---|
| Boiling Point | 572.4ºC at 760mmHg |
| Molecular Formula | C27H42O4 |
| Molecular Weight | 430.62000 |
| Flash Point | 186ºC |
| Exact Mass | 430.30800 |
| PSA | 66.76000 |
| LogP | 4.87650 |
| Vapour Pressure | 1.74E-15mmHg at 25°C |
| Index of Refraction | 1.539 |
| InChIKey | YHGXHXTZNBXLKF-RVKDJADKSA-N |
| SMILES | CC1=C(CCC(C)CO)OC2CC3C4CCC5CC(O)CCC5(C)C4CC(=O)C3(C)C12 |
|
~%
(25R)-3β,26-Dih... CAS#:11005-20-2 |
| Literature: Cameron et al. Journal of the Chemical Society, 1955 , p. 2807,2811 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Furost-20(22)-en-12-one,3,26-dihydroxy-,(3beta,5alpha,25R) |
| UNII-WM9H5883PL |