Destomycin B structure
|
Common Name | Destomycin B | ||
|---|---|---|---|---|
| CAS Number | 11005-98-4 | Molecular Weight | 541.54700 | |
| Density | 1.61g/cm3 | Boiling Point | 889.8ºC at 760 mmHg | |
| Molecular Formula | C21H39N3O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 491.9ºC | |
Use of Destomycin BDestomycin B (A-16316-C) is an antibiotic, and is active against fungi. Destomycin B also has anthelmintic activity[1]. |
| Name | 6'-(1-amino-2-hydroxyethyl)-4-[2,6-dihydroxy-3,5-bis(methylamino)cyclohexyl]oxy-6-(hydroxymethyl)spiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,2'-oxane]-3',4',5',7-tetrol |
|---|---|
| Synonym | More Synonyms |
| Description | Destomycin B (A-16316-C) is an antibiotic, and is active against fungi. Destomycin B also has anthelmintic activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.61g/cm3 |
|---|---|
| Boiling Point | 889.8ºC at 760 mmHg |
| Molecular Formula | C21H39N3O13 |
| Molecular Weight | 541.54700 |
| Flash Point | 491.9ºC |
| Exact Mass | 541.24800 |
| PSA | 258.07000 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.653 |
| InChIKey | XQRJFJIKNNEPNI-UHFFFAOYSA-N |
| SMILES | CNC1CC(NC)C(O)C(OC2OC(CO)C(O)C3OC4(OC(C(N)CO)C(O)C(O)C4O)OC23)C1O |
| Destomycin B |
| Destomycin C |