BOC-3-(3-QUINOLYL)-DL-ALA-OH structure
|
Common Name | BOC-3-(3-QUINOLYL)-DL-ALA-OH | ||
|---|---|---|---|---|
| CAS Number | 1100747-96-3 | Molecular Weight | 316.352 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 518.5±45.0 °C at 760 mmHg | |
| Molecular Formula | C17H20N2O4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 267.4±28.7 °C | |
Use of BOC-3-(3-QUINOLYL)-DL-ALA-OHBoc-3-(3-quinolyl)-DL-Ala-OH is a Boc-protected quinolyl Alanine derivative, can be used to synthesis compounds. |
| Name | N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-(3-quinolinyl)alanine |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-3-(3-quinolyl)-DL-Ala-OH is a Boc-protected quinolyl Alanine derivative, can be used to synthesis compounds. |
|---|---|
| Related Catalog |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 518.5±45.0 °C at 760 mmHg |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.352 |
| Flash Point | 267.4±28.7 °C |
| Exact Mass | 316.142303 |
| LogP | 2.83 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.590 |
| InChIKey | ZJIPRFVJGMPMPL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(Cc1cnc2ccccc2c1)C(=O)O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-(3-quinolinyl)alanine |
| 3-Quinolinepropanoic acid, α-[[(1,1-dimethylethoxy)carbonyl]amino]- |
| MFCD01632016 |
| MFCD01632015 |
| MFCD03453221 |