2'-fluoro-2',3'-dideoxyadenosine structure
|
Common Name | 2'-fluoro-2',3'-dideoxyadenosine | ||
|---|---|---|---|---|
| CAS Number | 110143-05-0 | Molecular Weight | 253.23300 | |
| Density | 1.85g/cm3 | Boiling Point | 541.3ºC at 760mmHg | |
| Molecular Formula | C10H12FN5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.2ºC | |
| Name | [(2S,4R,5R)-5-(6-aminopurin-9-yl)-4-fluorooxolan-2-yl]methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.85g/cm3 |
|---|---|
| Boiling Point | 541.3ºC at 760mmHg |
| Molecular Formula | C10H12FN5O2 |
| Molecular Weight | 253.23300 |
| Flash Point | 281.2ºC |
| Exact Mass | 253.09800 |
| PSA | 99.08000 |
| LogP | 0.60760 |
| Vapour Pressure | 1.5E-12mmHg at 25°C |
| Index of Refraction | 1.795 |
| InChIKey | KBEMFSMODRNJHE-BAJZRUMYSA-N |
| SMILES | Nc1ncnc2c1ncn2C1OC(CO)CC1F |
| HS Code | 2934999090 |
|---|
|
~94%
2'-fluoro-2',3'... CAS#:110143-05-0 |
| Literature: Journal of Medicinal Chemistry, , vol. 33, # 3 p. 978 - 985 |
|
~%
2'-fluoro-2',3'... CAS#:110143-05-0 |
| Literature: Journal of Medicinal Chemistry, , vol. 30, # 11 p. 2131 - 2137 |
|
~%
2'-fluoro-2',3'... CAS#:110143-05-0 |
| Literature: Journal of Medicinal Chemistry, , vol. 30, # 11 p. 2131 - 2137 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2'-Fluoro-2',3'-dideoxyadenosine |
| 2'-FddAdo |
| 2'-F-ribo-ddA |
| 2'-fluoro-ribo-2',3'-dideoxyadenosine |
| 2'-F-ddA |
| 2',3'-Dideoxy-2'-fluoroadenosine |
| Adenosine,2',3'-dideoxy-2'-fluoro |