4-(2-methyl-1,3-dioxolan-2-yl)cyclohepta[d]imidazol-2-amine structure
|
Common Name | 4-(2-methyl-1,3-dioxolan-2-yl)cyclohepta[d]imidazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 110167-02-7 | Molecular Weight | 231.25100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(2-methyl-1,3-dioxolan-2-yl)cyclohepta[d]imidazol-2-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H13N3O2 |
|---|---|
| Molecular Weight | 231.25100 |
| Exact Mass | 231.10100 |
| PSA | 70.99000 |
| LogP | 1.31320 |
| InChIKey | YYWVHLWMGFUICL-UHFFFAOYSA-N |
| SMILES | CC1(c2ccccc3nc(N)nc2-3)OCCO1 |
|
~71%
4-(2-methyl-1,3... CAS#:110167-02-7 |
| Literature: Bulletin of the Chemical Society of Japan, , vol. 60, # 1 p. 185 - 192 |
|
~21%
4-(2-methyl-1,3... CAS#:110167-02-7 |
| Literature: Bulletin of the Chemical Society of Japan, , vol. 60, # 1 p. 185 - 192 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-Cycloheptimidazolamine,4-(2-methyl-1,3-dioxolan-2-yl) |
| 2-amino-4-(2-methyl-1,3-dioxolan-2-yl)cycloheptimidazole |