(1R,9S,12R)-5-(trifluoromethyl)tricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-12-amine
Modify Date: 2026-07-17 11:56:51
![(1R,9S,12R)-5-(trifluoromethyl)tricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-12-amine Structure](https://www.chemsrc.com/extcaspic/436/110267-95-3.png)
(1R,9S,12R)-5-(trifluoromethyl)tricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-12-amine structure
|
Common Name | (1R,9S,12R)-5-(trifluoromethyl)tricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-12-amine | ||
|---|---|---|---|---|
| CAS Number | 110267-95-3 | Molecular Weight | 241.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14F3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1R,9S,12R)-5-(trifluoromethyl)tricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-12-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H14F3N |
|---|---|
| Molecular Weight | 241.25 |
| InChIKey | WOHWQAPSLJHLKN-UPZJHPNMSA-N |
| SMILES | NC1C2CCC1c1ccc(C(F)(F)F)cc1C2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (1R,9S,12R)-5-(trifluoromethyl)tricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-12-amine? |
| A: Molecular weight of (1R,9S,12R)-5-(trifluoromethyl)tricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-12-amine is 241.25. |
| Q: What is the English name of (1R,9S,12R)-5-(trifluoromethyl)tricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-12-amine? |
| A: The English name of (1R,9S,12R)-5-(trifluoromethyl)tricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-12-amine is (1R,9S,12R)-5-(trifluoromethyl)tricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-12-amine. |
| Q: What is the InChIKey of (1R,9S,12R)-5-(trifluoromethyl)tricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-12-amine? |
| A: InChIKey of (1R,9S,12R)-5-(trifluoromethyl)tricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-12-amine is WOHWQAPSLJHLKN-UPZJHPNMSA-N. |
| Q: What is the CAS number of (1R,9S,12R)-5-(trifluoromethyl)tricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-12-amine? |
| A: CAS number of (1R,9S,12R)-5-(trifluoromethyl)tricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-12-amine is 110267-95-3. |
| Q: What is the SMILES notation of (1R,9S,12R)-5-(trifluoromethyl)tricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-12-amine? |
| A: SMILES notation of (1R,9S,12R)-5-(trifluoromethyl)tricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-12-amine is NC1C2CCC1c1ccc(C(F)(F)F)cc1C2. |
| Q: What is the molecular formula of (1R,9S,12R)-5-(trifluoromethyl)tricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-12-amine? |
| A: Molecular formula of (1R,9S,12R)-5-(trifluoromethyl)tricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-12-amine is C13H14F3N. |
| Q: What is the Chinese name of 110267-95-3? |
| A: Chinese name of 110267-95-3 is 110267-95-3. |