Holothurin
Modify Date: 2026-09-28 14:13:53
Holothurin structure
|
Common Name | Holothurin | ||
|---|---|---|---|---|
| CAS Number | 11029-72-4 | Molecular Weight | 1189.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C54H85NaO25S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Holothurin |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C54H85NaO25S |
|---|---|
| Molecular Weight | 1189.3 |
| InChIKey | MAWWITJOQDJRJF-ADBICINLSA-M |
| SMILES | COC1C(O)C(C)OC(OC2C(O)C(C)OC(OC3C(C)OC(OC4C(OC5CCC6(C)C7=CC(O)C89C(=O)OC(C)(C%10CCC(C)(C)O%10)C8(O)CCC9(C)C7CCC6C5(C)C)OCC(OS(=O)(=O)[O-])C4O)C(O)C3O)C2O)C1O.[Na+] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Holothurin? |
| A: Molecular weight of Holothurin is 1189.3. |
| Q: What is the InChIKey of Holothurin? |
| A: InChIKey of Holothurin is MAWWITJOQDJRJF-ADBICINLSA-M. |
| Q: What is the English name of Holothurin? |
| A: The English name of Holothurin is Holothurin. |
| Q: What is the CAS number of Holothurin? |
| A: CAS number of Holothurin is 11029-72-4. |
| Q: What is the molecular formula of Holothurin? |
| A: Molecular formula of Holothurin is C54H85NaO25S. |
| Q: What is the Chinese name of 11029-72-4? |
| A: Chinese name of 11029-72-4 is 11029-72-4. |
| Q: What is the SMILES notation of Holothurin? |
| A: SMILES notation of Holothurin is COC1C(O)C(C)OC(OC2C(O)C(C)OC(OC3C(C)OC(OC4C(OC5CCC6(C)C7=CC(O)C89C(=O)OC(C)(C%10CCC(C)(C)O%10)C8(O)CCC9(C)C7CCC6C5(C)C)OCC(OS(=O)(=O)[O-])C4O)C(O)C3O)C2O)C1O.[Na+]. |