1,2-Bis(methylsulfonyl)-1-methylhydrazine structure
|
Common Name | 1,2-Bis(methylsulfonyl)-1-methylhydrazine | ||
|---|---|---|---|---|
| CAS Number | 110295-69-7 | Molecular Weight | 202.25200 | |
| Density | 1.485g/cm3 | Boiling Point | 317.7ºC at 760mmHg | |
| Molecular Formula | C3H10N2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.9ºC | |
| Name | N'-methyl-N'-methylsulfonylmethanesulfonohydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.485g/cm3 |
|---|---|
| Boiling Point | 317.7ºC at 760mmHg |
| Molecular Formula | C3H10N2O4S2 |
| Molecular Weight | 202.25200 |
| Flash Point | 145.9ºC |
| Exact Mass | 202.00800 |
| PSA | 100.31000 |
| LogP | 0.89450 |
| Vapour Pressure | 0.000379mmHg at 25°C |
| Index of Refraction | 1.515 |
| InChIKey | KYRBDGFWRYSMFS-UHFFFAOYSA-N |
| SMILES | CN(NS(C)(=O)=O)S(C)(=O)=O |
|
~32%
1,2-Bis(methyls... CAS#:110295-69-7 |
| Literature: Journal of Medicinal Chemistry, , vol. 30, # 11 p. 2157 - 2161 |
|
~0%
1,2-Bis(methyls... CAS#:110295-69-7 |
| Literature: Journal of Medicinal Chemistry, , vol. 33, # 8 p. 2259 - 2264 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Methanesulfonic acid,2-methyl-2-(methylsulfonyl)hydrazide |
| 1,2-Bis(methylsulfonyl)-1-methylhydrazine |
| 1,2-Bis(sulfonyl)-1-methylhydrazine |
| BMSMH |