5-(4-ethoxyphenyl)furan-2-carbaldehyde structure
|
Common Name | 5-(4-ethoxyphenyl)furan-2-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 110360-10-6 | Molecular Weight | 216.23300 | |
| Density | 1.139g/cm3 | Boiling Point | 370.2ºC at 760 mmHg | |
| Molecular Formula | C13H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.7ºC | |
| Name | 5-(4-ethoxyphenyl)furan-2-carbaldehyde |
|---|
| Density | 1.139g/cm3 |
|---|---|
| Boiling Point | 370.2ºC at 760 mmHg |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.23300 |
| Flash Point | 177.7ºC |
| Exact Mass | 216.07900 |
| PSA | 39.44000 |
| LogP | 3.15780 |
| Vapour Pressure | 1.12E-05mmHg at 25°C |
| Index of Refraction | 1.558 |
| InChIKey | WGDIFVYZWLGGJE-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(-c2ccc(C=O)o2)cc1 |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |