1-Propylpyridinium bis(trifluoromethylsulfonyl)imide
Modify Date: 2025-09-09 13:14:37
1-Propylpyridinium bis(trifluoromethylsulfonyl)imide structure
|
Common Name | 1-Propylpyridinium bis(trifluoromethylsulfonyl)imide | ||
|---|---|---|---|---|
| CAS Number | 1104525-90-7 | Molecular Weight | 402.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12F6N2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Propylpyridinium bis(trifluoromethylsulfonyl)imide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H12F6N2O4S2 |
|---|---|
| Molecular Weight | 402.3 |
| InChIKey | VWSBKZWRIXRCJK-UHFFFAOYSA-N |
| SMILES | CCC[n+]1ccccc1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1104525-90-7? |
| A: Chinese name of 1104525-90-7 is 1104525-90-7. |
| Q: What is the molecular formula of 1-Propylpyridinium bis(trifluoromethylsulfonyl)imide? |
| A: Molecular formula of 1-Propylpyridinium bis(trifluoromethylsulfonyl)imide is C10H12F6N2O4S2. |
| Q: What is the CAS number of 1-Propylpyridinium bis(trifluoromethylsulfonyl)imide? |
| A: CAS number of 1-Propylpyridinium bis(trifluoromethylsulfonyl)imide is 1104525-90-7. |
| Q: What is the English name of 1-Propylpyridinium bis(trifluoromethylsulfonyl)imide? |
| A: The English name of 1-Propylpyridinium bis(trifluoromethylsulfonyl)imide is 1-Propylpyridinium bis(trifluoromethylsulfonyl)imide. |
| Q: What is the InChIKey of 1-Propylpyridinium bis(trifluoromethylsulfonyl)imide? |
| A: InChIKey of 1-Propylpyridinium bis(trifluoromethylsulfonyl)imide is VWSBKZWRIXRCJK-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1-Propylpyridinium bis(trifluoromethylsulfonyl)imide? |
| A: Molecular weight of 1-Propylpyridinium bis(trifluoromethylsulfonyl)imide is 402.3. |
| Q: What is the SMILES notation of 1-Propylpyridinium bis(trifluoromethylsulfonyl)imide? |
| A: SMILES notation of 1-Propylpyridinium bis(trifluoromethylsulfonyl)imide is CCC[n+]1ccccc1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F. |