methyl (20β)-16(E),17-didehydro-9,17-dimethoxycorynan-16-carboxylate, compound with picric acid (1:1) structure
|
Common Name | methyl (20β)-16(E),17-didehydro-9,17-dimethoxycorynan-16-carboxylate, compound with picric acid (1:1) | ||
|---|---|---|---|---|
| CAS Number | 11047-43-1 | Molecular Weight | 627.599 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H33N5O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Mitragynine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C29H33N5O11 |
|---|---|
| Molecular Weight | 627.599 |
| Exact Mass | 627.217651 |
| InChIKey | IHGAWJFMFZKUCI-STQPJIQFSA-N |
| SMILES | CCC1CN2CCc3c([nH]c4cccc(OC)c34)C2CC1C(=COC)C(=O)OC.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| Mitragynine |
| Indolo[2,3-a]quinolizine-2-acetic acid, 3-ethyl-1,2,3,4,6,7,12,12b-octahydro-8-methoxy-α-(methoxymethylene)-, methyl ester, (αE,2S,3S,12bS)-, compd. with 2,4,6-trinitrophenol (1:1) |
| Corynan-16-carboxylic acid, 16,17-didehydro-9,17-dimethoxy-, methyl ester, (16E,20β)-, compd. with 2,4,6-trinitrophenol (1:1) |
| Methyl (16E,20β)-9-methoxy-16-(methoxymethylene)corynan-17-oate - 2,4,6-trinitrophenol (1:1) |