1,3-bis[4-(3-Aminophenoxy)benzoyl]benzene structure
|
Common Name | 1,3-bis[4-(3-Aminophenoxy)benzoyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 110471-15-3 | Molecular Weight | 500.544 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 726.6±60.0 °C at 760 mmHg | |
| Molecular Formula | C32H24N2O4 | Melting Point | 147-148ºC | |
| MSDS | N/A | Flash Point | 254.6±29.2 °C | |
| Name | [3-[4-(3-aminophenoxy)benzoyl]phenyl]-[4-(3-aminophenoxy)phenyl]methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 726.6±60.0 °C at 760 mmHg |
| Melting Point | 147-148ºC |
| Molecular Formula | C32H24N2O4 |
| Molecular Weight | 500.544 |
| Flash Point | 254.6±29.2 °C |
| Exact Mass | 500.173615 |
| PSA | 104.64000 |
| LogP | 5.75 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.676 |
| InChIKey | WYYLAHMAYZBJOI-UHFFFAOYSA-N |
| SMILES | Nc1cccc(Oc2ccc(C(=O)c3cccc(C(=O)c4ccc(Oc5cccc(N)c5)cc4)c3)cc2)c1 |
|
~62%
1,3-bis[4-(3-Am... CAS#:110471-15-3 |
| Literature: Journal of Polymer Science, Part A: Polymer Chemistry, , vol. 48, # 13 p. 2878 - 2884 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,3-Phenylenebis{[4-(3-aminophenoxy)phenyl]methanone} |
| 1,3-Bis[4-(3-aminophenoxy)benzoyl]benzene |