2-O,4-O-dicyclohexyl 1-O-hexyl benzene-1,2,4-tricarboxylate structure
|
Common Name | 2-O,4-O-dicyclohexyl 1-O-hexyl benzene-1,2,4-tricarboxylate | ||
|---|---|---|---|---|
| CAS Number | 110475-01-9 | Molecular Weight | 458.58700 | |
| Density | 1.13g/cm3 | Boiling Point | 544.9ºC at 760 mmHg | |
| Molecular Formula | C27H38O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.1ºC | |
| Name | 2-O,4-O-dicyclohexyl 1-O-hexyl benzene-1,2,4-tricarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 544.9ºC at 760 mmHg |
| Molecular Formula | C27H38O6 |
| Molecular Weight | 458.58700 |
| Flash Point | 230.1ºC |
| Exact Mass | 458.26700 |
| PSA | 78.90000 |
| LogP | 6.40270 |
| Vapour Pressure | 6.23E-12mmHg at 25°C |
| Index of Refraction | 1.533 |
| InChIKey | LUVTVPLLIUIVOH-UHFFFAOYSA-N |
| SMILES | CCCCCCOC(=O)c1ccc(C(=O)OC2CCCCC2)cc1C(=O)OC1CCCCC1 |
| 2,4-dicyclohexyl 1-hexyl benzene-1,2,4-tricarboxylate |
| 1,2,4-Benzenetricarboxylic acid,mixed cyclohexyl and hexyl esters |