MHP structure
|
Common Name | MHP | ||
|---|---|---|---|---|
| CAS Number | 1104874-94-3 | Molecular Weight | 293.35800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MHPMHP is an activator of sphingosine kinase (SPHK1), and significantly stimulates CAMP mRNA and protein production in KC. |
| Name | methyl (2S)-2-(hexanoylamino)-3-(4-hydroxyphenyl)propanoate |
|---|---|
| Synonym | More Synonyms |
| Description | MHP is an activator of sphingosine kinase (SPHK1), and significantly stimulates CAMP mRNA and protein production in KC. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C16H23NO4 |
|---|---|
| Molecular Weight | 293.35800 |
| Exact Mass | 293.16300 |
| PSA | 79.12000 |
| LogP | 3.01310 |
| InChIKey | GBTVWZMJUZJPBU-AWEZNQCLSA-N |
| SMILES | CCCCCC(=O)NC(Cc1ccc(O)cc1)C(=O)OC |
| Storage condition | 2-8℃ |
| N-Hexanoyltyrosine methyl ester |
| Defensamide |
| UNII-8GJP2KSJ0T |
| MHP |