N-(2-(3,5-dimethylphenoxy)ethyl)-2-(4-methoxyphenyl)acetamide
Modify Date: 2026-05-13 15:35:02
N-(2-(3,5-dimethylphenoxy)ethyl)-2-(4-methoxyphenyl)acetamide structure
|
Common Name | N-(2-(3,5-dimethylphenoxy)ethyl)-2-(4-methoxyphenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 1105211-06-0 | Molecular Weight | 313.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(2-(3,5-dimethylphenoxy)ethyl)-2-(4-methoxyphenyl)acetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H23NO3 |
|---|---|
| Molecular Weight | 313.4 |
| InChIKey | XSDAZLPATOQQAD-UHFFFAOYSA-N |
| SMILES | COc1ccc(CC(=O)NCCOc2cc(C)cc(C)c2)cc1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
|
Name: Modulation of AMPAR-stargazin complexes
Source: Vanderbilt Screening Center for GPCRs, Ion Channels and Transporters
Target: Stargazin (mouse)
External Id: WaveGuideAssay:441
|
|
Name: Discovering small molecule activators of G protein-gated inwardly-rectifying potassiu...
Source: 15621
Target: G protein-activated inward rectifier potassium channel 2
External Id: VANDERBILT_HTS_GIRK2_HPP
|
Total 4, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N-(2-(3,5-dimethylphenoxy)ethyl)-2-(4-methoxyphenyl)acetamide? |
| A: CAS number of N-(2-(3,5-dimethylphenoxy)ethyl)-2-(4-methoxyphenyl)acetamide is 1105211-06-0. |
| Q: What is the SMILES notation of N-(2-(3,5-dimethylphenoxy)ethyl)-2-(4-methoxyphenyl)acetamide? |
| A: SMILES notation of N-(2-(3,5-dimethylphenoxy)ethyl)-2-(4-methoxyphenyl)acetamide is COc1ccc(CC(=O)NCCOc2cc(C)cc(C)c2)cc1. |
| Q: What is the molecular formula of N-(2-(3,5-dimethylphenoxy)ethyl)-2-(4-methoxyphenyl)acetamide? |
| A: Molecular formula of N-(2-(3,5-dimethylphenoxy)ethyl)-2-(4-methoxyphenyl)acetamide is C19H23NO3. |
| Q: What is the Chinese name of 1105211-06-0? |
| A: Chinese name of 1105211-06-0 is COc1ccc(CC(=O)NCCOc2cc(C)cc(C)c2)cc1. |
| Q: What is the molecular weight of N-(2-(3,5-dimethylphenoxy)ethyl)-2-(4-methoxyphenyl)acetamide? |
| A: Molecular weight of N-(2-(3,5-dimethylphenoxy)ethyl)-2-(4-methoxyphenyl)acetamide is 313.4. |
| Q: What is the InChIKey of N-(2-(3,5-dimethylphenoxy)ethyl)-2-(4-methoxyphenyl)acetamide? |
| A: InChIKey of N-(2-(3,5-dimethylphenoxy)ethyl)-2-(4-methoxyphenyl)acetamide is XSDAZLPATOQQAD-UHFFFAOYSA-N. |
| Q: What is the English name of N-(2-(3,5-dimethylphenoxy)ethyl)-2-(4-methoxyphenyl)acetamide? |
| A: The English name of N-(2-(3,5-dimethylphenoxy)ethyl)-2-(4-methoxyphenyl)acetamide is N-(2-(3,5-dimethylphenoxy)ethyl)-2-(4-methoxyphenyl)acetamide. |