N-(2-(3,5-dimethylphenoxy)ethyl)-4-fluorobenzenesulfonamide
Modify Date: 2025-10-14 20:30:59
N-(2-(3,5-dimethylphenoxy)ethyl)-4-fluorobenzenesulfonamide structure
|
Common Name | N-(2-(3,5-dimethylphenoxy)ethyl)-4-fluorobenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 1105221-49-5 | Molecular Weight | 323.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18FNO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(2-(3,5-dimethylphenoxy)ethyl)-4-fluorobenzenesulfonamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H18FNO3S |
|---|---|
| Molecular Weight | 323.4 |
| InChIKey | AXUSRJAVYQSPQB-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)cc(OCCNS(=O)(=O)c2ccc(F)cc2)c1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of N-(2-(3,5-dimethylphenoxy)ethyl)-4-fluorobenzenesulfonamide? |
| A: Molecular weight of N-(2-(3,5-dimethylphenoxy)ethyl)-4-fluorobenzenesulfonamide is 323.4. |
| Q: What is the InChIKey of N-(2-(3,5-dimethylphenoxy)ethyl)-4-fluorobenzenesulfonamide? |
| A: InChIKey of N-(2-(3,5-dimethylphenoxy)ethyl)-4-fluorobenzenesulfonamide is AXUSRJAVYQSPQB-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1105221-49-5? |
| A: Chinese name of 1105221-49-5 is Cc1cc(C)cc(OCCNS(=O)(=O)c2ccc(F)cc2)c1. |
| Q: What is the CAS number of N-(2-(3,5-dimethylphenoxy)ethyl)-4-fluorobenzenesulfonamide? |
| A: CAS number of N-(2-(3,5-dimethylphenoxy)ethyl)-4-fluorobenzenesulfonamide is 1105221-49-5. |
| Q: What is the molecular formula of N-(2-(3,5-dimethylphenoxy)ethyl)-4-fluorobenzenesulfonamide? |
| A: Molecular formula of N-(2-(3,5-dimethylphenoxy)ethyl)-4-fluorobenzenesulfonamide is C16H18FNO3S. |
| Q: What is the English name of N-(2-(3,5-dimethylphenoxy)ethyl)-4-fluorobenzenesulfonamide? |
| A: The English name of N-(2-(3,5-dimethylphenoxy)ethyl)-4-fluorobenzenesulfonamide is N-(2-(3,5-dimethylphenoxy)ethyl)-4-fluorobenzenesulfonamide. |
| Q: What is the SMILES notation of N-(2-(3,5-dimethylphenoxy)ethyl)-4-fluorobenzenesulfonamide? |
| A: SMILES notation of N-(2-(3,5-dimethylphenoxy)ethyl)-4-fluorobenzenesulfonamide is Cc1cc(C)cc(OCCNS(=O)(=O)c2ccc(F)cc2)c1. |