(+)-ethyl 1,4-dihydro-1-[1(R)-(hydroxymethyl)ethyl]-4-oxo-6,7,8-trifluoroquinoline-3-carboxylate structure
|
Common Name | (+)-ethyl 1,4-dihydro-1-[1(R)-(hydroxymethyl)ethyl]-4-oxo-6,7,8-trifluoroquinoline-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 110548-05-5 | Molecular Weight | 329.27100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14F3NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (+)-ethyl 1,4-dihydro-1-[1(R)-(hydroxymethyl)ethyl]-4-oxo-6,7,8-trifluoroquinoline-3-carboxylate |
|---|
| Molecular Formula | C15H14F3NO4 |
|---|---|
| Molecular Weight | 329.27100 |
| Exact Mass | 329.08700 |
| PSA | 68.53000 |
| LogP | 2.14880 |
| InChIKey | KPRHARRBWYSCDE-SSDOTTSWSA-N |
| SMILES | CCOC(=O)c1cn(C(C)CO)c2c(F)c(F)c(F)cc2c1=O |
|
~13%
(+)-ethyl 1,4-d... CAS#:110548-05-5 |
| Literature: Mitscher; Sharma; Chu; Shen; Pernet Journal of Medicinal Chemistry, 1987 , vol. 30, # 12 p. 2283 - 2286 |
|
~%
(+)-ethyl 1,4-d... CAS#:110548-05-5 |
| Literature: Mitscher; Sharma; Chu; Shen; Pernet Journal of Medicinal Chemistry, 1987 , vol. 30, # 12 p. 2283 - 2286 |