Funiculosine
Modify Date: 2025-09-12 10:43:30
Funiculosine structure
|
Common Name | Funiculosine | ||
|---|---|---|---|---|
| CAS Number | 11055-06-4 | Molecular Weight | 491.61700 | |
| Density | 1.278g/cm3 | Boiling Point | 623ºC at 760mmHg | |
| Molecular Formula | C27H41NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 330.6ºC | |
Use of FuniculosineFuniculosin is a neutral lipophilic antibiotic that inhibits DNA and RNA viruses. Funiculosin also has antifungal activity. Funiculosin inhibits infections caused by pathogenic fungi in primary chicken embryo fibroblasts[1]. |
| Name | 3-[(6S)-6-[(E,4S,6R)-4,6-dimethyloct-2-en-2-yl]-5-methyl-3,6-dihydro-2H-pyran-2-yl]-4-hydroxy-1-methyl-5-[(2R,3R,4S,5R)-2,3,4,5-tetrahydroxycyclopentyl]pyridin-2-one |
|---|---|
| Synonym | More Synonyms |
| Description | Funiculosin is a neutral lipophilic antibiotic that inhibits DNA and RNA viruses. Funiculosin also has antifungal activity. Funiculosin inhibits infections caused by pathogenic fungi in primary chicken embryo fibroblasts[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.278g/cm3 |
|---|---|
| Boiling Point | 623ºC at 760mmHg |
| Molecular Formula | C27H41NO7 |
| Molecular Weight | 491.61700 |
| Flash Point | 330.6ºC |
| Exact Mass | 491.28800 |
| PSA | 132.38000 |
| LogP | 2.42660 |
| Vapour Pressure | 3.96E-18mmHg at 25°C |
| Index of Refraction | 1.606 |
| InChIKey | UTZTYDYZCJIRLN-ZPXUAEPASA-N |
| SMILES | CCC(C)CC(C)C=C(C)C1OC(c2c(O)c(C3C(O)C(O)C(O)C3O)cn(C)c2=O)CC=C1C |
| funiculosin |
| Funiculosine |
| Funiculosin (pyridone) |
| 3-[(6S)-6-[(E,4S,6R)-4,6-dimethyloct-2-en-2-yl]-5-methyl-3,6-dihydro-2H-pyran-2-yl]-2-hydroxy-1-methyl-5-[(2R,3R,4S,5R)-2,3,4,5-tetrahydroxycyclopentyl]pyridin-4-one |
| 4-hydroxy-1-methyl-3-[(2R)-5-methyl-6c-((1E,3R,5R)-1,3,5-trimethyl-hept-1-enyl)-3,6-dihydro-2H-pyran-2r-yl]-5-(2c,3c,4c,5c-tetrahydroxy-cyclopent-r-yl)-1H-pyridin-2-one |
| Funiculosin (antibiotic) |
| 2(1H)-Pyridinone,3-(3,6-dihydro-5-methyl-6-(1,3,5-trimethyl-1-heptenyl)-2H-pyran-2-yl)-4-hydroxy-1-methyl-5-(2,3,4,5-tetrahydroxycyclopentyl)-,stereoisomer |