(1S,2S,3S,5S)-5-Azido-3-(phenylmethoxy)-2-[(phenylmethoxy)methyl]cyclopentanol structure
|
Common Name | (1S,2S,3S,5S)-5-Azido-3-(phenylmethoxy)-2-[(phenylmethoxy)methyl]cyclopentanol | ||
|---|---|---|---|---|
| CAS Number | 110567-23-2 | Molecular Weight | 353.41500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H23N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (1S,2S,3S,5S)-5-Azido-3-(phenylmethoxy)-2-[(phenylmethoxy)methyl]cyclopentanol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H23N3O3 |
|---|---|
| Molecular Weight | 353.41500 |
| Exact Mass | 353.17400 |
| PSA | 88.44000 |
| LogP | 3.30106 |
| InChIKey | XJPSKFVIPXVHTA-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NC1CC(OCc2ccccc2)C(COCc2ccccc2)C1O |
|
~99%
(1S,2S,3S,5S)-5... CAS#:110567-23-2 |
| Literature: Tran, Scott B.; Ekhato, Ihoezo V.; Rinehart, J. Kent Journal of Labelled Compounds and Radiopharmaceuticals, 2009 , vol. 52, # 11 p. 485 - 489 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| (1R,2S,3S,5S)-5-azido-3-phenylmethoxy-2-(phenylmethoxymethyl)cyclopentan-1-ol |