1-bromo-3-(3-bromo-2-methoxyphenyl)-2-methoxybenzene structure
|
Common Name | 1-bromo-3-(3-bromo-2-methoxyphenyl)-2-methoxybenzene | ||
|---|---|---|---|---|
| CAS Number | 110569-96-5 | Molecular Weight | 372.05200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12Br2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-bromo-3-(3-bromo-2-methoxyphenyl)-2-methoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H12Br2O2 |
|---|---|
| Molecular Weight | 372.05200 |
| Exact Mass | 369.92000 |
| PSA | 18.46000 |
| LogP | 4.89580 |
| InChIKey | SNXOCGJCAWYKMB-UHFFFAOYSA-N |
| SMILES | COc1c(Br)cccc1-c1cccc(Br)c1OC |
|
~%
1-bromo-3-(3-br... CAS#:110569-96-5 |
| Literature: Cram,D.J.; Carmack,R.A.; Degrandpre,M.P. Journal of the American Chemical Society, 1987 , vol. 109, p. 7068 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,1'-Biphenyl,3,3'-dibromo-2,2'-dimethoxy |
| 3,3'-dibromo-2,2'-dimethoxy-1,1'-biphenyl |