1,2-diphenyl-4-[2-(phenylsulphonyl)ethyl]pyrazolidine-3,5-dione structure
|
Common Name | 1,2-diphenyl-4-[2-(phenylsulphonyl)ethyl]pyrazolidine-3,5-dione | ||
|---|---|---|---|---|
| CAS Number | 1106-50-9 | Molecular Weight | 420.48100 | |
| Density | 1.33g/cm3 | Boiling Point | 609.4ºC at 760mmHg | |
| Molecular Formula | C23H20N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 322.3ºC | |
| Name | 1,2-diphenyl-4-[2-(phenylsulphonyl)ethyl]pyrazolidine-3,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 609.4ºC at 760mmHg |
| Molecular Formula | C23H20N2O4S |
| Molecular Weight | 420.48100 |
| Flash Point | 322.3ºC |
| Exact Mass | 420.11400 |
| PSA | 83.14000 |
| LogP | 4.67240 |
| Vapour Pressure | 8.6E-15mmHg at 25°C |
| Index of Refraction | 1.641 |
| InChIKey | DQUYGWDNTAETLI-UHFFFAOYSA-N |
| SMILES | O=C1C(CCS(=O)(=O)c2ccccc2)C(=O)N(c2ccccc2)N1c1ccccc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,2-Diphenyl-4-[2-(phenylsulfonyl)ethyl]-3,5-pyrazolidinedione |
| Sulfinpyrazone sulfone |
| 1,2-diphenyl-4-[2-(phenylsulfonyl)ethyl]pyrazolidine-3,5-dione |
| EINECS 214-169-5 |
| 4-(2-benzenesulfonyl-ethyl)-1,2-diphenyl-pyrazolidine-3,5-dione |