N-[2-Methyl-4-(oxiranylmethoxy)phenyl]-N-(oxiranylmethyl)oxiranemethanamine structure
|
Common Name | N-[2-Methyl-4-(oxiranylmethoxy)phenyl]-N-(oxiranylmethyl)oxiranemethanamine | ||
|---|---|---|---|---|
| CAS Number | 110656-67-2 | Molecular Weight | 291.34200 | |
| Density | 1.274±0.06 g/cm3(Predicted) | Boiling Point | 466.3±30.0 °C(Predicted) | |
| Molecular Formula | C16H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-4-(oxiran-2-ylmethoxy)-N,N-bis(oxiran-2-ylmethyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.274±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 466.3±30.0 °C(Predicted) |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.34200 |
| Exact Mass | 291.14700 |
| PSA | 50.06000 |
| LogP | 1.37660 |
| InChIKey | IWRZKNMUSBNOOD-UHFFFAOYSA-N |
| SMILES | Cc1cc(OCC2CO2)ccc1N(CC1CO1)CC1CO1 |
| Storage condition | 2-8℃ |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Oxiranemethanamine,N-[2-methyl-4-(2-oxiranylmethoxy)phenyl]-N-(2-oxiranylmethyl) |