2-BROMO-1-(4-IMIDAZOL-1-YL-PHENYL)ETHANONE structure
|
Common Name | 2-BROMO-1-(4-IMIDAZOL-1-YL-PHENYL)ETHANONE | ||
|---|---|---|---|---|
| CAS Number | 110668-69-4 | Molecular Weight | 265.10600 | |
| Density | 1.48 g/cm3 | Boiling Point | 405ºC at 760 mmHg | |
| Molecular Formula | C11H9BrN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.7ºC | |
| Name | 2-bromo-1-(4-imidazol-1-ylphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48 g/cm3 |
|---|---|
| Boiling Point | 405ºC at 760 mmHg |
| Molecular Formula | C11H9BrN2O |
| Molecular Weight | 265.10600 |
| Flash Point | 198.7ºC |
| Exact Mass | 263.99000 |
| PSA | 34.89000 |
| LogP | 2.44990 |
| Index of Refraction | 1.632 |
| InChIKey | DDQNJOAJAWHIFL-UHFFFAOYSA-N |
| SMILES | O=C(CBr)c1ccc(-n2ccnc2)cc1 |
| HS Code | 2933290090 |
|---|
|
~%
2-BROMO-1-(4-IM... CAS#:110668-69-4 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 17, # 15 p. 4374 - 4377 |
|
~%
2-BROMO-1-(4-IM... CAS#:110668-69-4 |
| Literature: Keith, John M.; Gomez, Leslie A.; Barbier, Ann J.; Wilson, Sandy J.; Boggs, Jamin D.; Lord, Brian; Mazur, Curt; Aluisio, Leah; Lovenberg, Timothy W.; Carruthers, Nicholas I. Bioorganic and Medicinal Chemistry Letters, 2007 , vol. 17, # 15 p. 4374 - 4377 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Bromo-4`-(imidazol-1-yl)acetophenone |
| 2-Bromo-1-[4-(1H-Imidazol-1-Yl)Phenyl]-Ethanone |
| 2-Bromo-1-(4-imidazol-1-yl-phenyl)ethanone |
| Ethanone,2-bromo-1-[4-(1H-imidazol-1-yl)phenyl] |