1-Benzyl-1-(3-(4-bromophenoxy)-2-hydroxypropyl)piperidin-1-ium chloride
Modify Date: 2025-10-24 11:37:53
1-Benzyl-1-(3-(4-bromophenoxy)-2-hydroxypropyl)piperidin-1-ium chloride structure
|
Common Name | 1-Benzyl-1-(3-(4-bromophenoxy)-2-hydroxypropyl)piperidin-1-ium chloride | ||
|---|---|---|---|---|
| CAS Number | 1106880-99-2 | Molecular Weight | 440.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H27BrClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Benzyl-1-(3-(4-bromophenoxy)-2-hydroxypropyl)piperidin-1-ium chloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H27BrClNO2 |
|---|---|
| Molecular Weight | 440.8 |
| InChIKey | MHQFXXDSRKDFHW-UHFFFAOYSA-M |
| SMILES | OC(COc1ccc(Br)cc1)C[N+]1(Cc2ccccc2)CCCCC1.[Cl-] |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
|
Name: Modulation of AMPAR-stargazin complexes
Source: Vanderbilt Screening Center for GPCRs, Ion Channels and Transporters
Target: Stargazin (mouse)
External Id: WaveGuideAssay:441
|
Total 2, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-Benzyl-1-(3-(4-bromophenoxy)-2-hydroxypropyl)piperidin-1-ium chloride? |
| A: Molecular weight of 1-Benzyl-1-(3-(4-bromophenoxy)-2-hydroxypropyl)piperidin-1-ium chloride is 440.8. |
| Q: What is the Chinese name of 1106880-99-2? |
| A: Chinese name of 1106880-99-2 is 1106880-99-2. |
| Q: What is the InChIKey of 1-Benzyl-1-(3-(4-bromophenoxy)-2-hydroxypropyl)piperidin-1-ium chloride? |
| A: InChIKey of 1-Benzyl-1-(3-(4-bromophenoxy)-2-hydroxypropyl)piperidin-1-ium chloride is MHQFXXDSRKDFHW-UHFFFAOYSA-M. |
| Q: What is the English name of 1-Benzyl-1-(3-(4-bromophenoxy)-2-hydroxypropyl)piperidin-1-ium chloride? |
| A: The English name of 1-Benzyl-1-(3-(4-bromophenoxy)-2-hydroxypropyl)piperidin-1-ium chloride is 1-Benzyl-1-(3-(4-bromophenoxy)-2-hydroxypropyl)piperidin-1-ium chloride. |
| Q: What is the SMILES notation of 1-Benzyl-1-(3-(4-bromophenoxy)-2-hydroxypropyl)piperidin-1-ium chloride? |
| A: SMILES notation of 1-Benzyl-1-(3-(4-bromophenoxy)-2-hydroxypropyl)piperidin-1-ium chloride is OC(COc1ccc(Br)cc1)C[N+]1(Cc2ccccc2)CCCCC1.[Cl-]. |
| Q: What is the CAS number of 1-Benzyl-1-(3-(4-bromophenoxy)-2-hydroxypropyl)piperidin-1-ium chloride? |
| A: CAS number of 1-Benzyl-1-(3-(4-bromophenoxy)-2-hydroxypropyl)piperidin-1-ium chloride is 1106880-99-2. |
| Q: What is the molecular formula of 1-Benzyl-1-(3-(4-bromophenoxy)-2-hydroxypropyl)piperidin-1-ium chloride? |
| A: Molecular formula of 1-Benzyl-1-(3-(4-bromophenoxy)-2-hydroxypropyl)piperidin-1-ium chloride is C21H27BrClNO2. |