methyl 4-acetamido-2-hydroxy-3-prop-2-enylbenzoate structure
|
Common Name | methyl 4-acetamido-2-hydroxy-3-prop-2-enylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 110751-41-2 | Molecular Weight | 249.26200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 4-acetamido-2-hydroxy-3-prop-2-enylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H15NO4 |
|---|---|
| Molecular Weight | 249.26200 |
| Exact Mass | 249.10000 |
| PSA | 79.12000 |
| LogP | 2.51520 |
| InChIKey | WPIUICUWBBLVAJ-UHFFFAOYSA-N |
| SMILES | C=CCc1c(NC(C)=O)ccc(C(=O)OC)c1O |
|
~97%
methyl 4-acetam... CAS#:110751-41-2 |
| Literature: Kakigami, Takuji; Usui, Toshinao; Tsukamoto, Katsura; Kataoka, Tadashi Chemical and Pharmaceutical Bulletin, 1998 , vol. 46, # 1 p. 42 - 52 |
|
~%
methyl 4-acetam... CAS#:110751-41-2 |
| Literature: Kakigami, Takuji; Usui, Toshinao; Tsukamoto, Katsura; Kataoka, Tadashi Chemical and Pharmaceutical Bulletin, 1998 , vol. 46, # 1 p. 42 - 52 |
| methyl 3-allyl-4-acetylaminosalicylate |
| Benzoic acid,4-(acetylamino)-2-hydroxy-3-(2-propenyl)-,methyl ester |
| methyl 2-hydroxy-3-allyl-4-acetaminobenzoate |
| 4-acetylamino-3-allyl-2-hydroxy-benzoic acid methyl ester |