Tetramycin structure
|
Common Name | Tetramycin | ||
|---|---|---|---|---|
| CAS Number | 11076-50-9 | Molecular Weight | 695.79400 | |
| Density | 1.33g/cm3 | Boiling Point | 960.2ºC at 760mmHg | |
| Molecular Formula | C35H53NO13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 534.5ºC | |
Use of TetramycinTetramycin (Tetramycin A) is an antifungal active substance of strain BS-112. Tetramycin inhibits Aspergillus flavus with the MFC (minimum fugicide concentration) is 3.13 μg/mL[1]. |
| Name | 3-(4-amino-3,5-dihydroxy-6-methyloxan-2-yl)oxy-12-ethyl-19,21,23,25-tetrahydroxy-13-methyl-15-oxo-14,27-dioxabicyclo[21.3.1]heptacosa-4,6,8,10,16-pentaene-26-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Tetramycin (Tetramycin A) is an antifungal active substance of strain BS-112. Tetramycin inhibits Aspergillus flavus with the MFC (minimum fugicide concentration) is 3.13 μg/mL[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 960.2ºC at 760mmHg |
| Molecular Formula | C35H53NO13 |
| Molecular Weight | 695.79400 |
| Flash Point | 534.5ºC |
| Exact Mass | 695.35200 |
| PSA | 238.69000 |
| LogP | 1.43970 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | DVWJFTGEISXVSH-BTWJUTKQSA-N |
| SMILES | CCC1C=CC=CC=CC=CC(OC2OC(C)C(O)C(N)C2O)CC2OC(O)(CC(O)CC(O)CC=CC(=O)OC1C)CC(O)C2C(=O)O |
| Cupric sulfate,ammoniated |
| copper azane sulfate hydrate |
| tetramycin A |
| Ammoniated cupric sulfate,monohydrate |
| Copper(2+),tetraammine-,sulfate (1:1),monohydrate |
| tetramminecopper(II) sulfate monohydrate |