Hexanedioic acid,2,5-bis(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)-, dimethyl ester (9CI) structure
|
Common Name | Hexanedioic acid,2,5-bis(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)-, dimethyl ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 1109-18-8 | Molecular Weight | 464.42400 | |
| Density | 1.447g/cm3 | Boiling Point | 628.1ºC at 760mmHg | |
| Molecular Formula | C24H20N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 333.6ºC | |
| Name | dimethyl 2,5-bis(1,3-dioxoisoindol-2-yl)hexanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.447g/cm3 |
|---|---|
| Boiling Point | 628.1ºC at 760mmHg |
| Molecular Formula | C24H20N2O8 |
| Molecular Weight | 464.42400 |
| Flash Point | 333.6ºC |
| Exact Mass | 464.12200 |
| PSA | 127.36000 |
| LogP | 1.31800 |
| Vapour Pressure | 1.09E-15mmHg at 25°C |
| Index of Refraction | 1.627 |
| InChIKey | WCLYVNPYCVTHFL-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CCC(C(=O)OC)N1C(=O)c2ccccc2C1=O)N1C(=O)c2ccccc2C1=O |
| HS Code | 2925190090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,5-diphthalimido-adipic acid dimethyl ester |
| 2,5-Diphthalimido-adipinsaeure-dimethylester |
| dimethyl 2,5-bis(1,3-dioxo-1,3-dihydro-2h-isoindol-2-yl)hexanedioate |