14(S),15(R)-epoxyeicosatrienoic acid methyl ester
Modify Date: 2026-06-30 18:19:02
14(S),15(R)-epoxyeicosatrienoic acid methyl ester structure
|
Common Name | 14(S),15(R)-epoxyeicosatrienoic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 110901-52-5 | Molecular Weight | 334.49300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H34O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 14(S),15(R)-epoxyeicosatrienoic acid methyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H34O3 |
|---|---|
| Molecular Weight | 334.49300 |
| Exact Mass | 334.25100 |
| PSA | 38.83000 |
| LogP | 5.51630 |
| InChIKey | MQCWCUDQEBWUAM-AWVFLLPBSA-N |
| SMILES | CCCCCC1OC1CC=CCC=CCC=CCCCC(=O)OC |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:70219-57-7This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 14(S),15(R)-epoxyeicosatrienoic acid methyl ester? |
| A: Polar surface area (PSA) of 14(S),15(R)-epoxyeicosatrienoic acid methyl ester is 38.83000. |
| Q: What is the LogP of 14(S),15(R)-epoxyeicosatrienoic acid methyl ester? |
| A: LogP of 14(S),15(R)-epoxyeicosatrienoic acid methyl ester is 5.51630. |
| Q: What is the InChIKey of 14(S),15(R)-epoxyeicosatrienoic acid methyl ester? |
| A: InChIKey of 14(S),15(R)-epoxyeicosatrienoic acid methyl ester is MQCWCUDQEBWUAM-AWVFLLPBSA-N. |
| Q: What is the English name of 14(S),15(R)-epoxyeicosatrienoic acid methyl ester? |
| A: The English name of 14(S),15(R)-epoxyeicosatrienoic acid methyl ester is 14(S),15(R)-epoxyeicosatrienoic acid methyl ester. |
| Q: What is the SMILES notation of 14(S),15(R)-epoxyeicosatrienoic acid methyl ester? |
| A: SMILES notation of 14(S),15(R)-epoxyeicosatrienoic acid methyl ester is CCCCCC1OC1CC=CCC=CCC=CCCCC(=O)OC. |
| Q: What is the CAS number of 14(S),15(R)-epoxyeicosatrienoic acid methyl ester? |
| A: CAS number of 14(S),15(R)-epoxyeicosatrienoic acid methyl ester is 110901-52-5. |
| Q: What are the downstream products of 14(S),15(R)-epoxyeicosatrienoic acid methyl ester? |
| A: Related downstream products(CAS) of 14(S),15(R)-epoxyeicosatrienoic acid methyl ester: 70219-57-7. |
| Q: What is the molecular formula of 14(S),15(R)-epoxyeicosatrienoic acid methyl ester? |
| A: Molecular formula of 14(S),15(R)-epoxyeicosatrienoic acid methyl ester is C21H34O3. |
| Q: What is the Chinese name of 110901-52-5? |
| A: Chinese name of 110901-52-5 is 110901-52-5. |
| Q: What is the molecular weight of 14(S),15(R)-epoxyeicosatrienoic acid methyl ester? |
| A: Molecular weight of 14(S),15(R)-epoxyeicosatrienoic acid methyl ester is 334.49300. |